|
| BC-1258 Basic information |
Product Name: | BC-1258 | Synonyms: | N,N′-Bis-(4-thiazol-2-yl-benzyl)-ethane-1,2-diamine;BC-1258;N,N'-bis[[4-(1,3-thiazol-2-yl)phenyl]methyl]ethane-1,2-diamine;1,2-Ethanediamine, N1,N2-bis[[4-(2-thiazolyl)phenyl]methyl]-;LRR,F-box,inhibit,repeat,BC-?1258,BC ?1258,FBXL2,Apoptosis,tumor,Inhibitor,BC?1258;N1,N2-Bis(4-(thiazol-2-yl)benzyl)ethane-1,2-diamine | CAS: | 1507370-40-2 | MF: | C22H22N4S2 | MW: | 406.57 | EINECS: | | Product Categories: | | Mol File: | 1507370-40-2.mol | |
| BC-1258 Chemical Properties |
storage temp. | 2-8°C | solubility | DMSO: soluble10mg/mL, clear (warmed) | form | powder | color | white to beige | InChI | InChI=1S/C22H22N4S2/c1-5-19(21-25-11-13-27-21)6-2-17(1)15-23-9-10-24-16-18-3-7-20(8-4-18)22-26-12-14-28-22/h1-8,11-14,23-24H,9-10,15-16H2 | InChIKey | FRTSLZJCGAFSET-UHFFFAOYSA-N | SMILES | C(NCC1=CC=C(C2=NC=CS2)C=C1)CNCC1=CC=C(C2=NC=CS2)C=C1 |
| BC-1258 Usage And Synthesis |
Description | BC-1258 (N,N′-Bis-(4-thiazol-2-yl-benzyl)-ethane-1,2-diamine) is a potent activator of unique E3 ligase F-box/LRR-repeat protein 2 (FBXL2) that increases levels of FBXLs protein, thus promoting Aurora B degradation. BC-1258 induces mitotic arrest and apoptosis of tumorigenic cells. Also BC-1258 inhibits tumor formation in athymic nude mice. | Mechanism of action | BC-1258 is a unique small molecule F-box/LRR-repeat protein 2 (FBXL2) activator that stabilized and increased levels of FBXL2 protein that promoted Aurora B degradation, resulting in tetraploidy, mitotic arrest and apoptosis of tumorigenic cells, and profoundly inhibiting tumor formation in athymic nude mice. It is sufficient to stabilize and upregulate FBXL2 levels, and, when administered in vivo, prematurely depletes Aurora B by SCFFBXL2-induced ubiquitination and degradation, leading to cell death and inhibiting growth of human leukemic cells in a xenograft model[1]. | References | [1] B B Chen. “Skp-cullin-F box E3 ligase component FBXL2 ubiquitinates Aurora B to inhibit tumorigenesis.” Cell Death & Disease (2013): e759. |
| BC-1258 Preparation Products And Raw materials |
|