|
|
| | 3-Methylbenzyl cyanide Basic information |
| | 3-Methylbenzyl cyanide Chemical Properties |
| Boiling point | 240-241 °C(lit.) | | density | 1.002 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.52(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light orange to Yellow | | Specific Gravity | 1.002 | | Water Solubility | INSOLUBLE | | BRN | 1099644 | | Exposure limits | NIOSH: IDLH 25 mg/m3 | | InChI | InChI=1S/C9H9N/c1-8-3-2-4-9(7-8)5-6-10/h2-4,7H,5H2,1H3 | | InChIKey | WOJADIOTNFDWNQ-UHFFFAOYSA-N | | SMILES | C1(CC#N)=CC=CC(C)=C1 | | CAS DataBase Reference | 2947-60-6(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Tolylacetic acid nitrile(2947-60-6) |
| | 3-Methylbenzyl cyanide Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid | | Uses | (3-Methylphenyl)acetonitrile was used as a reactant to synthesize potential non-nucleoside reverse transcriptase inhibitors (NNRTIs) against HIV. It was also used as a reactant to prepare hepatitis C virus inhibitors. |
| | 3-Methylbenzyl cyanide Preparation Products And Raw materials |
|