| Identification | Back Directory | [Name]
(R)-N-FMoc-2-(2'-propynyl)alanine | [CAS]
1198791-65-9 | [Synonyms]
Fmoc-alpha-Prg-L-Ala-OH Fmoc-(R)-propargyl-Ala-OH (R)-N-FMOC-Α-PROPARGYLALANINE FMoc-α-Me-D-Gly(Propargyl)-OH (R)-N-FMoc-2-(2'-propynyl)alanine (R)-N-Fmoc-2-(2'-propynyl)alanine, >97% Fmoc-(R)-2-amino-2-methylpent-4-ynoic acid N-α-(9-Fluorenylmethoxycarbonyl)-α-methyl-D-α-propargylglycine (9H-Fluoren-9-yl)MethOxy]Carbonyl Alpha-Methyl-D-Gly(Propargyl)-OH (R)-2-((((9H-Fluoren-9-yl)Methoxy)carbonyl)aMino)-2-Methylpent-4-ynoic acid (2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-2-methylpent-4-ynoic acid 4-Pentynoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2-methyl-, (2R)- | [Molecular Formula]
C21H19NO4 | [MDL Number]
MFCD12031694 | [MOL File]
1198791-65-9.mol | [Molecular Weight]
349.38 |
| Chemical Properties | Back Directory | [Boiling point ]
576.8±50.0 °C(Predicted) | [density ]
1.267±0.06 g/cm3(Predicted) | [storage temp. ]
-20°C | [form ]
liquid | [pka]
3.51±0.11(Predicted) | [color ]
pale yellow | [Major Application]
peptide synthesis | [InChI]
1S/C21H19NO4/c1-3-12-21(2,19(23)24)22-20(25)26-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h1,4-11,18H,12-13H2,2H3,(H,22,25)(H,23,24)/t21-/m1/s1 | [InChIKey]
ZXOKSWZUJXKQCQ-OAQYLSRUSA-N | [SMILES]
O=C(N[C@](C)(CC#C)C(O)=O)OCC1C2=CC=CC=C2C3=C1C=CC=C3 |
| Hazard Information | Back Directory | [Uses]
Alkyne amino acid, more stable for peptide stapling via click chemistry than propargylglycine. | [Uses]
Fmoc-?(R)?-?propargyl-?Ala-?OH is a chiral reagent used in the preparation of peptidomimetic macrocycles for the transport of biomolecules. | [reaction suitability]
reaction type: click chemistry |
|
| Company Name: |
ChemPep, Inc.
|
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Website: |
www.chempep.com |
| Company Name: |
Cool Pharm, Ltd
|
| Tel: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Shanghai GL Peptide Ltd.
|
| Tel: |
+86-21-61263340; 17609490614 13764994101 |
| Website: |
https://www.chemicalbook.com/supplier/10480342/ |
| Company Name: |
BePharm Ltd
|
| Tel: |
400-685-9117 |
| Website: |
www.bepharm.com |
|