| Identification | Back Directory | [Name]
(S)-N-FMoc-2-(5'-pentenyl)alanine | [CAS]
288617-74-3 | [Synonyms]
FMoc-α-Me-Gly(Hexenyl)-OH Fmoc-a-Me-Gly(Hexenyl)-OH (S)-N-Fmoc-2-(5'-hexyl)alanine (S)-N-FMoc-2-(5'-hexenyl)alanine (S)-N-FMoc-2-(5'-pentenyl)alanine (S)-N-Fmoc-2-(5'-pentenyl)alanine, >97% Fmoc-(S)-2-amino-2-methyloct-7-enoic acid (S)-2-(Fmoc-amino)-2-methyloct-7-enoic acid (9H-Fluoren-9-yl)MethOxy]Carbonyl Alpha-Methyl-Gly(Hexenyl)-OH N-α-(9-Fluorenylmethoxycarbonyl)-α-methyl-L-α-(5-hexenyl)glycine (S)-2-((((9H-Fluoren-9-yl)Methoxy)carbonyl)aMino)-2-Methyloct-7-enoic acid (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-2-methyloct-7-enoic acid 7-?Octenoic acid, 2-?[[(9H-?fluoren-?9-?ylmethoxy)?carbonyl]?amino]?-?2-?methyl-?, (2S)?- | [Molecular Formula]
C24H27NO4 | [MOL File]
288617-74-3.mol | [Molecular Weight]
393.48 |
| Chemical Properties | Back Directory | [Boiling point ]
605.3±55.0 °C(Predicted) | [density ]
1.169±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [pka]
3.94±0.41(Predicted) | [InChIKey]
QVNDFQWCJFAEFY-DEOSSOPVSA-N | [SMILES]
C(O)(=O)[C@](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)(C)CCCCC=C |
| Hazard Information | Back Directory | [Uses]
(S)-N-FMoc-2-(5'-pentenyl)alanine, also known as Fmoc-(S)-2-(5-hexenyl)alanine or (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methyloct-7-enoic acid, is utilized in the preparation of stapled peptides by ring closing metathesis. Store at -4 C.
|
|
| Company Name: |
ChemPep, Inc.
|
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Website: |
www.chempep.com |
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Shanghai GL Peptide Ltd.
|
| Tel: |
+86-21-61263340; 17609490614 13764994101 |
| Website: |
https://www.chemicalbook.com/supplier/10480342/ |
| Company Name: |
BePharm Ltd
|
| Tel: |
400-685-9117 |
| Website: |
www.bepharm.com |
|