| Identification | Back Directory | [Name]
TRIISOPROPYLPHOSPHONIUM TETRAFLUOROBORATE | [CAS]
121099-07-8 | [Synonyms]
Triisopropylphosphine Tetrafluoroborate TRIISOPROPYLPHOSPHONIUM TETRAFLUOROBORATE tris(isopropyl)phosphonium tetrafluoroborate Triisopropylphosphonium tetrafluoroborate 97% Tri-i-propylphosphoniuM tetrafluoroborate, 99% Tris(1-methylethyl)phosphine tetrafluoroborate | [Molecular Formula]
C9H22BF4P | [MDL Number]
MFCD06796644 | [MOL File]
121099-07-8.mol | [Molecular Weight]
248.05 |
| Chemical Properties | Back Directory | [storage temp. ]
under inert gas (nitrogen or Argon) at 2-8°C | [form ]
powder | [InChI]
1S/C9H21P.BF4/c1-7(2)10(8(3)4)9(5)6;2-1(3,4)5/h7-9H,1-6H3;/q;-1/p+1 | [InChIKey]
KGBIZABAOCDZNU-UHFFFAOYSA-O | [SMILES]
F[B-](F)(F)F.CC(C)[PH+](C(C)C)C(C)C |
| Hazard Information | Back Directory | [Uses]
Reactant for:
- Synthesis of triisopropylphosphine complexes of ruthenium(II)
- Imine hydrogenation
- Dihydride and alkene-η6-arene complexes
| [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Domole Scientific
|
| Tel: |
13275595566; 13275595566 |
| Website: |
http://www.domole.com/ |
|