Identification | Back Directory | [Name]
HYPOCRELLIN B | [CAS]
123940-54-5 | [Synonyms]
HC-B HYPOCRELLIN B HYPOCRELLIN B, HYPOCRELLA BAMBUSAE 1H-Cyclohepta[ghi]perylene- 5,12-dione, 3-acetyl-6,11-dihydroxy-4, 8,9,13-tetramethoxy-2-methyl- | [EINECS(EC#)]
213-551-9 | [Molecular Formula]
C30H24O9 | [MDL Number]
MFCD00467741 | [MOL File]
123940-54-5.mol | [Molecular Weight]
528.51 |
Chemical Properties | Back Directory | [Melting point ]
261-263℃ | [Boiling point ]
893.8±65.0 °C(Predicted) | [density ]
1.52±0.1 g/cm3 (20 ºC 760 Torr) | [storage temp. ]
-20°C | [solubility ]
DMF: soluble; DMSO: soluble | [form ]
A crystalline solid | [pka]
6.62±0.40(Predicted) | [color ]
Brown to black | [InChIKey]
KPGRZWCQXQUGHK-UHFFFAOYSA-N | [SMILES]
C1(=O)C2=C3C4=C5C6C(=C(OC)C=C(O)C=62)C(OC)=CC5=C(O)C(=O)C(OC)=C4CC(C)=C3C(C(C)=O)=C1OC |
Hazard Information | Back Directory | [Uses]
Hypocrellin B is an apoptosis inducer. | [in vivo]
Hypocrellin B (2 mg/kg, i.v.) inhibits tumor growth in A549 tumor bearing mice, but the anticancer efficacy is less than hypocrellin B loaded nanoparticles[4].
| [IC 50]
Leishmania |
|
|