| Identification | Back Directory | [Name]
Hydroxy Adapalene | [CAS]
1346599-76-5 | [Synonyms]
ADAP-IMD Hydroxy Adapalene Adapalene Hydroxy Adapalene Impurity 2 Adapalene EP Impurity B Adapalene Impurity 2(Adapalene EP Impurity B) Adapalene EP Impurity B (Adapalene 3-Hydroxy Impurity) 6-[3-(3-hydroxy-1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylic acid 6-[3-(3-Hydroxytricyclo[3.3.1.13,7]dec-1-yl)-4-methoxyphenyl]-2-naphthalenecarboxylic Acid 2-Naphthalenecarboxylic acid, 6-[3-(3-hydroxytricyclo[3.3.1.13,7]dec-1-yl)-4-methoxyphenyl]- 6-[3-(3-Hydroxytricyclo[3.3.1.13,7]dec-1-yl)-4- (methyloxy)phenyl]naphthalene-2-carboxylic acid | [Molecular Formula]
C28H28O4 | [MOL File]
1346599-76-5.mol | [Molecular Weight]
428.52 |
| Chemical Properties | Back Directory | [Melting point ]
>282oC (dec.) | [Boiling point ]
639.6±55.0 °C(Predicted) | [density ]
1.314±0.06 g/cm3(Predicted) | [storage temp. ]
Refrigerator | [solubility ]
DMSO (Slightly), Methanol (Slightly, Heated) | [form ]
Solid | [pka]
4.23±0.30(Predicted) | [color ]
White to Pale Beige | [InChIKey]
ZVFMDETWRVTMJF-UHFFFAOYSA-N | [SMILES]
C1=C2C(C=C(C3=CC=C(OC)C(C45CC6CC(CC(O)(C6)C4)C5)=C3)C=C2)=CC=C1C(O)=O |
| Hazard Information | Back Directory | [Uses]
A potential metabolite of Adapalene (A225000). | [Uses]
A potential metabolite of Adapalene (A225000). Adapalene EP Impurity B |
|
| Company Name: |
OPULENT PHARMA
|
| Tel: |
+91-9106692785 |
| Website: |
www.www.NOWEBSITE |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
|