| Identification | Back Directory | [Name]
bortezoMib iMpurity H | [CAS]
1446194-56-4 | [Synonyms]
Bortezomib Imp.H
Bortezomib Impurity S
bortezoMib iMpurity H
(S)-N-(1-(isopentylaMino)-1-oxo-3-phenylpropan-2-yl)pyrazine-2-carboxaMide
2-Pyrazinecarboxamide, N-[(1S)-2-[(3-methylbutyl)amino]-2-oxo-1-(phenylmethyl)ethyl]-
Bortezomib impurity 11/(S)-N-(1-(Isopentylamino)-1-oxo-3-phenylpropan-2-yl)pyrazine-2-carboxamide | [Molecular Formula]
C19H24N4O2 | [MOL File]
1446194-56-4.mol | [Molecular Weight]
340.42 |
| Chemical Properties | Back Directory | [solubility ]
Chloroform (Slightly), Dichloromethane (Slightly) | [form ]
Solid | [color ]
White to Off-White | [InChI]
InChI=1S/C19H24N4O2/c1-14(2)8-9-22-18(24)16(12-15-6-4-3-5-7-15)23-19(25)17-13-20-10-11-21-17/h3-7,10-11,13-14,16H,8-9,12H2,1-2H3,(H,22,24)(H,23,25)/t16-/m0/s1 | [InChIKey]
UJZOAWFAGJVEGQ-INIZCTEOSA-N | [SMILES]
C1(C(N[C@@H](CC2=CC=CC=C2)C(NCCC(C)C)=O)=O)=NC=CN=C1 |
| Hazard Information | Back Directory | [Uses]
N-[(1S)-2-[(3-Methylbutyl)amino]-2-oxo-1-(phenylmethyl)ethyl]-2-pyrazinecarboxamide is an impurity of Bortezomib (B675700) which is the first proteasome inhibitor to be approved by the US FDA for multiple myeloma, a blood cancer. A reversible inhibitor of the 26S proteasome-a barrel-shaped multiprotein particle found in the nucleus and cytosol of all eukaryotic cells. Targets the ubiquitin-proteasome pathway. |
|
| Company Name: |
Alputon Inc.
|
| Telephone: |
021-60753308-14013 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList13466/0_EN.htm |
| Company Name: |
Roark Standards
|
| Telephone: |
0755-83552066 15986688328 |
| Website: |
roarkstandards.com |
| Company Name: |
TOSUN PHARM
|
| Telephone: |
020-66392521-118 18922260391 |
| Website: |
www.toref.cn/ |
| Company Name: |
sgtlifesciences pvt ltd
|
| Telephone: |
+91-8790379245 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList1846349/0.htm |
|