Identification | Back Directory | [Name]
2-bromo-5-methyl-phenol | [CAS]
14847-51-9 | [Synonyms]
Nsc21719 2-bromo-5-methyl-phenol Phenol, 2-bromo-5-methyl- | [Molecular Formula]
C7H7BrO | [MDL Number]
MFCD11100989 | [MOL File]
14847-51-9.mol | [Molecular Weight]
187.03 |
Chemical Properties | Back Directory | [Melting point ]
38.8°C | [Boiling point ]
209°C (rough estimate) | [density ]
1.3839 (rough estimate) | [refractive index ]
1.5772 (estimate) | [storage temp. ]
2-8°C | [solubility ]
Chloroform (Slightly), DMSO (Slightly) | [form ]
Solid | [pka]
8.54±0.10(Predicted) | [color ]
Dark Brown to Very Dark Brown | [InChI]
InChI=1S/C7H7BrO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3 | [InChIKey]
WWGPJMNOBVKDQO-UHFFFAOYSA-N | [SMILES]
C1(O)=CC(C)=CC=C1Br |
Hazard Information | Back Directory | [Synthesis]
2-bromo-5-methyl-phenol can be synthesized through several methods. One
common method involves the bromination of 5-methylphenol (m-cresol)
using bromine in the presence of a catalyst such as iron powder. The reaction typically occurs under controlled temperature conditions to ensure selective bromination at the desired position. |
|
|