| Identification | Back Directory | [Name]
N-(3-chloro-4-fluorophenyl)-6 ,7-dimethoxyquinazolin-4-amine | [CAS]
153437-78-6 | [Synonyms]
Gefitinib-6
Gefitinib Impurity 2
Gefitinib impurities136
4-Quinazolinamine, N-(3-chloro-4-fluorophenyl)-6,7-dimethoxy-
Gefitinib impurity 5/N-(3-chloro-4-fluorophenyl)-6 ,7-dimethoxyquinazolin-4-amine
Gefitinib Impurity IIQ: What is
Gefitinib Impurity II Q: What is the CAS Number of
Gefitinib Impurity II | [Molecular Formula]
C16H13ClFN3O2 | [MDL Number]
MFCD00924023 | [MOL File]
153437-78-6.mol | [Molecular Weight]
333.74 |
| Hazard Information | Back Directory | [Uses]
O-Desmorpholinopropyl-O-methyl-gefitinib is a anilinoquinazoline derivative of which acts as an inhibitor of tyrosine kinases and found to be allosteric inhibitors of the enzyme frutose 1,6-bisphosphatase. It serves as a lead to further drug design. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
| Company Name: |
Roark Standards
|
| Tel: |
0755-83552066 15986688328 |
| Website: |
roarkstandards.com |
|