| Identification | Back Directory | [Name]
7-Bromoindole-2-carboxylic acid | [CAS]
16732-71-1 | [Synonyms]
7-BROMOINDOLE-2-CARBOXYLIC ACID 7-BROMO-2-INDOLECARBOXYLIC ACID (2Z)-2-hexylidene-1-cyclohexanone 7-BROMO-1H-INDOLE-2-CARBOXYLIC ACID 1H-Indole-2-carboxylic acid, 7-bromo- | [EINECS(EC#)]
201-215-5 | [Molecular Formula]
C9H6BrNO2 | [MDL Number]
MFCD00744954 | [MOL File]
16732-71-1.mol | [Molecular Weight]
240.05 |
| Chemical Properties | Back Directory | [Melting point ]
238-243°C | [Boiling point ]
470.9±25.0 °C(Predicted) | [density ]
1.838±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [form ]
solid | [pka]
4.22±0.30(Predicted) | [Appearance]
White to light yellow Solid | [InChI]
1S/C9H6BrNO2/c10-6-3-1-2-5-4-7(9(12)13)11-8(5)6/h1-4,11H,(H,12,13) | [InChIKey]
ZKGMXVLKFBRKNN-UHFFFAOYSA-N | [SMILES]
OC(C1=CC2=C(N1)C(Br)=CC=C2)=O |
| Hazard Information | Back Directory | [Uses]
7-Bromoindole-2-carboxylic acid is an organic compound that is often used as a synthetic intermediate for drugs, dyes, and other chemical products. |
|
| Company Name: |
Shangchem Co., Ltd.
|
| Telephone: |
+86-21-68182121 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList14031/0_EN.htm |
| Company Name: |
skychemical Co.Ltd
|
| Telephone: |
021-20958197 20965099 |
| Website: |
www.skychemical.com |
|