| Identification | More | [Name]
2,3,4,5-Tetrahydro-1H-benzo[b]azepine | [CAS]
1701-57-1 | [Synonyms]
2,3,4,5-TETRAHYDRO-1H-BENZO[B]AZEPINE
2,3,4,5-TETRAHYDRO-1H-BENZO[B]AZEPINE HYDROCHLORIDE | [Molecular Formula]
C10H13N | [MDL Number]
MFCD00272363 | [Molecular Weight]
147.22 | [MOL File]
1701-57-1.mol |
| Chemical Properties | Back Directory | [Melting point ]
32 °C | [Boiling point ]
253-255 °C | [density ]
1.03250061035156 g/cm3 | [storage temp. ]
Keep in dark place,Inert atmosphere,Room temperature | [pka]
5.22±0.20(Predicted) | [InChI]
InChI=1S/C10H13N/c1-2-7-10-9(5-1)6-3-4-8-11-10/h1-2,5,7,11H,3-4,6,8H2 | [InChIKey]
MZBVNYACSSGXID-UHFFFAOYSA-N | [SMILES]
N1C2=CC=CC=C2CCCC1 | [CAS DataBase Reference]
1701-57-1(CAS DataBase Reference) |
| Hazard Information | Back Directory | [Uses]
2,3,4,5-Tetrahydro-1H-1-benzazepine is a reactant in the synthesis of adamantane derivatives as cannabinoid receptor 2 agonists. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Jia Xing Isenchem Co.,Ltd
|
| Telephone: |
0573-85285100 18627885956 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList14265/0_EN.htm |
| Company Name: |
Shangchem Co., Ltd.
|
| Telephone: |
+86-21-68182121 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList14031/0_EN.htm |
| Company Name: |
Shanghai Ennopharm Co., Ltd.
|
| Telephone: |
+86 (21) 6435-5022 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList13640/0_EN.htm |
| Company Name: |
skychemical Co.Ltd
|
| Telephone: |
021-20958197 20965099 |
| Website: |
www.skychemical.com |
|