| Identification | Back Directory | [Name]
(1S,2S)-(-)-N-(4-TOLUENESULPHONYL)-1,2-DIAMINOCYCLOHEXANE | [CAS]
174291-97-5 | [Synonyms]
(1S,2S)-N-p-Tosyl-1,2-cyclohexanediamine,99%e.e.
(1S,2S)-(-)-N-(4-TOLUENESULPHONYL)-1,2-DIAMINOCYCLOHEXANE
Benzenesulfonamide, N-[(1S,2S)-2-aminocyclohexyl]-4-methyl- | [Molecular Formula]
C13H20N2O2S | [MDL Number]
MFCD09265104 | [MOL File]
174291-97-5.mol | [Molecular Weight]
268.38 |
| Chemical Properties | Back Directory | [Melting point ]
106-110°C | [Boiling point ]
417.4±55.0 °C(Predicted) | [density ]
1.23±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C, protect from light, stored under nitrogen | [form ]
solid | [pka]
11.69±0.40(Predicted) | [Appearance]
White to off-white Solid | [Optical Rotation]
[α]/D +26.0 to 34.0°, c = 1 in chloroform | [InChI]
1S/C13H20N2O2S/c1-10-6-8-11(9-7-10)18(16,17)15-13-5-3-2-4-12(13)14/h6-9,12-13,15H,2-5,14H2,1H3/t12-,13-/m0/s1 | [InChIKey]
VVOFSHARRCJLLA-STQMWFEESA-N | [SMILES]
Cc1ccc(cc1)S(=O)(=O)N[C@H]2CCCC[C@@H]2N |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|