| Identification | More | [Name]
2,4-Difluoro-3-methoxybenzoic acid | [CAS]
178974-97-5 | [Synonyms]
2,4-DIFLUORO-3-METHOXYBENZOIC ACID
2,4-Difluoro-3-methoxylbenzoic acid
2,4-Difluoro-3-methoxybenzoic acid, 98+%
2,4-Difluoro-3-methoxybenzoic acid, 97+% | [EINECS(EC#)]
1533716-785-6 | [Molecular Formula]
C8H6F2O3 | [MDL Number]
MFCD02258905 | [Molecular Weight]
188.13 | [MOL File]
178974-97-5.mol |
| Chemical Properties | Back Directory | [Melting point ]
193-195°C | [Boiling point ]
298.7±35.0 °C(Predicted) | [density ]
1.399±0.06 g/cm3(Predicted) | [refractive index ]
n20D 1.51 (Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [form ]
powder to crystal | [pka]
3.09±0.10(Predicted) | [color ]
White to Light yellow | [Water Solubility ]
Insoluble in water. | [InChI]
InChI=1S/C8H6F2O3/c1-13-7-5(9)3-2-4(6(7)10)8(11)12/h2-3H,1H3,(H,11,12) | [InChIKey]
KWLIGHXPUYUTBH-UHFFFAOYSA-N | [SMILES]
C(O)(=O)C1=CC=C(F)C(OC)=C1F | [CAS DataBase Reference]
178974-97-5(CAS DataBase Reference) |
|
| Company Name: |
Alfa Aesar
|
| Telephone: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Jia Xing Isenchem Co.,Ltd
|
| Telephone: |
0573-85285100 18627885956 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList14265/0_EN.htm |
|