| Identification | Back Directory | [Name]
MPEG11-CH2CH2COOH | [CAS]
2135793-73-4 | [Synonyms]
mPEG11-COOH m-dPEG12-acid MPEG11-CH2CH2COOH Methyl-PEG12-Carboxylic Acid 4,7,10,13,16,19,22,25,28,31,34,37-Dodecaoxaoctatriacontanoic acid 2,5,8,11,14,17,20,23,26,29,32,35-Dodecaoxaoctatriacontan-38-oic Acid | [Molecular Formula]
C26H52O14 | [MDL Number]
MFCD08274611 | [MOL File]
2135793-73-4.mol | [Molecular Weight]
588.68 |
| Chemical Properties | Back Directory | [Boiling point ]
628.8±55.0 °C(Predicted) | [density ]
1.113±0.06 g/cm3(Predicted) | [solubility ]
Soluble in Water, DMSO, DCM, DMF | [form ]
liquid | [pka]
4.28±0.10(Predicted) | [color ]
Colourless | [InChI]
InChI=1S/C26H52O14/c1-29-4-5-31-8-9-33-12-13-35-16-17-37-20-21-39-24-25-40-23-22-38-19-18-36-15-14-34-11-10-32-7-6-30-3-2-26(27)28/h2-25H2,1H3,(H,27,28) | [InChIKey]
JMAKFNFKUHXFBH-UHFFFAOYSA-N | [SMILES]
C(O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC |
| Hazard Information | Back Directory | [Description]
m-PEG12-acid is a PEG linker containing a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media. | [Uses]
MeO-?PEG(12)?-?COOH is used in the preparation of fishbone-?like polymer brushes with potential applications in the production of smart materials and biosensors. | [IC 50]
PEGs |
|
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|