| Identification | Back Directory | [Name]
PCy3 Pd G4 | [CAS]
2195390-53-3 | [Synonyms]
PCy3 Pd G4
METHANESULFONATO(TRICYCLOHEXYLPHOSPHINO)(2'-METHYLAMINO-1,1'-BIPHENYL-2-YL)PALLADIUM(II), | [Molecular Formula]
C32H48NO3PPdS | [MDL Number]
MFCD30480498 | [MOL File]
2195390-53-3.mol | [Molecular Weight]
664.19 |
| Chemical Properties | Back Directory | [Melting point ]
214-219°C | [storage temp. ]
2-8°C, protect from light | [form ]
powder | [Appearance]
Off-white to light yellow Solid | [InChIKey]
UYGVSLRBJGQYQM-UHFFFAOYSA-N | [SMILES]
P(C1CCCCC1)(C1CCCCC1)(C1CCCCC1)[Pd+2]1(N(C2=CC=CC=C2C2=CC=CC=[C-]12)C)[O-]S(=O)(=O)C |
| Hazard Information | Back Directory | [Uses]
A powerful ligand for classic cross-coupling reactions combined with the Buchwald Fourth Generation Palladacycle. Bench stable, soluble in most organic solvents. | [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst
reaction type: Cross Couplings |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|