| Identification | Back Directory | [Name]
PHYTIC ACID CALCIUM | [CAS]
23183-60-0 | [Synonyms]
Phytic acid calcium salt >=90% myo-Inositol hexakis(dihydrogen phosphate) calcium salt (1:1) | [Molecular Formula]
C6H20CaO24P6 | [MDL Number]
MFCD00082315 | [MOL File]
23183-60-0.mol | [Molecular Weight]
702.12 |
| Chemical Properties | Back Directory | [storage temp. ]
desiccated | [form ]
powder | [SMILES]
[Mg++].[Ca++].OP(O)(=O)O[C@@H]1[C@@H](OP(O)(O)=O)[C@@H](OP(O)([O-])=O)[C@@H](OP(O)([O-])=O)[C@H](OP(O)([O-])=O)[C@H]1OP(O)([O-])=O |
| Hazard Information | Back Directory | [Uses]
Phytic acid (calcium) is a biochemical assay reagent. | [Biochem/physiol Actions]
Phytic acid is present in all eukaryotic cells. In plants, it is known to function as a [PO4]3? storage depot and precursor for other inositol phosphates and pyrophosphates. Its high surface negative charge makes it a potent chelator of divalent and trivalent cations in vitro, and it is most likely associated with Ca2+ or Mg2+ ions in vivo. In yeast, phytic acid acts with the nuclear pore protein Gle1 to regulate the nuclear export of mRNA by coactivating the RNA-dependent ATPase activity of DExD-box protein 5 (Dbp5). |
|
| Company Name: |
RYSS TECH LTD
|
| Tel: |
400-188-0725 +86 21 34310725 13611771617 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15256/0_EN.htm |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|