| Identification | Back Directory | [Name]
1-(4-Dimethylaminophenyl)-2,2,2-trifluoroethanone | [CAS]
2396-05-6 | [Synonyms]
4'-(DIMETHYLAMINO)-2,2,2-TRIFLUOROACETOPHENONE 4'-N,N-DIMETHYLAMINO-2,2,2-TRIFLUOROACETOPHENONE 1-(4-DIMETHYLAMINOPHENYL)-2,2,2-TRIFLUOROETHANONE 4'-(DiMethylaMino)-2,2,2-trifluoroacetophenone 97% 1-(4-(Dimethylamino)phenyl)-2,2,2-trifluoroethan-1-one Ethanone, 1-[4-(dimethylamino)phenyl]-2,2,2-trifluoro- Ethanone, 1-[4-(dimethylamino)phenyl]-2,2,2-trifluoro- (9CI) | [Molecular Formula]
C10H10F3NO | [MDL Number]
MFCD00099468 | [MOL File]
2396-05-6.mol | [Molecular Weight]
217.19 |
| Chemical Properties | Back Directory | [Melting point ]
72-76 °C(lit.) | [Boiling point ]
265.8±40.0 °C(Predicted) | [density ]
1.238±0.06 g/cm3(Predicted) | [pka]
1.41±0.12(Predicted) | [InChI]
1S/C10H10F3NO/c1-14(2)8-5-3-7(4-6-8)9(15)10(11,12)13/h3-6H,1-2H3 | [InChIKey]
NDKSWWUQHXZADC-UHFFFAOYSA-N | [SMILES]
CN(C)c1ccc(cc1)C(=O)C(F)(F)F |
| Hazard Information | Back Directory | [Uses]
1-(4-Dimethylaminophenyl)-2,2,2-trifluoroethanone is an organic compound that is often used as a synthetic intermediate to synthesize organic compounds with specific functions, such as fluorescent dyes and biomarker molecules. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Tetranov Biopharm
|
| Tel: |
13526569071 |
| Website: |
http://www.leadmedpharm.com/index.html |
|