| Identification | Back Directory | [Name]
(R,S)-3-[1-(Dimethylamino)ethyl]phenyl dimethylcarbamate | [CAS]
25081-93-0 | [Synonyms]
Lysine impurity 13 RivastigMine USP RC B Desmethyl Rivastigmine Rivastigmine EP Impurity B RivastigMine Related CoMpound B Rivastigmine USP Related Compound B 3-(1-(diMethylaMino)ethyl)phenyl diMethylcarbaMate N-Dimethyl Rivastigmine (Rivastigmine EP Impurity B) Rivastigmine Hydrogen Tartrate Impurity B as Racemate (RS)-3-[1-(Dimethylamino)ethyl]phenyl dimethylcarbamate Rivastigmine Hydrogen Tartrate EP Impurity B as Racemate [3-[1-(dimethylamino)ethyl]phenyl] N,N-dimethylcarbamate 3-[1-(Dimethylamino)ethyl]phenol dimethylcarbamate (ester) Carbamic acid, N,N-dimethyl-, 3-[1-(dimethylamino)ethyl]phenyl ester N,N-Dimethylcarbamic acid 3-[(RS)-1-(dimethyl amino) ethyl]phenyl ester Rivastigmine Related Compound B (15 mg) ((R,S)-3-[1-(Dimethylamino)ethyl]phenyl dimethylcarbamate) Rivastigmine Related Compound B ((R,S)-3-[1-(Dimethylamino)ethyl]phenyl dimethylcarbamate) (1604870) | [Molecular Formula]
C13H20N2O2 | [MDL Number]
MFCD22056680 | [MOL File]
25081-93-0.mol | [Molecular Weight]
236.31 |
| Chemical Properties | Back Directory | [Boiling point ]
299.4±32.0 °C(Predicted) | [density ]
1.051±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [form ]
liquid | [pka]
8.58±0.50(Predicted) | [Major Application]
pharmaceutical (small molecule) | [InChI]
1S/C13H20N2O2/c1-10(14(2)3)11-7-6-8-12(9-11)17-13(16)15(4)5/h6-10H,1-5H3 | [InChIKey]
AIHREYCBCYOMLZ-UHFFFAOYSA-N | [SMILES]
N(C(C)c1cc(ccc1)OC(=O)N(C)C)(C)C |
| Hazard Information | Back Directory | [Uses]
(R,S)-3-[1-(Dimethylamino)ethyl]phenyl dimethylcarbamate is an impurity of Rivastigmine (R541000), a brain selective acetylcholinesterase inhibitor used as a nootropic agent.
| [Uses]
N-Desethyl N-Methyl rac-Rivastigmine (Rivastigmin USP Related Compound B) is an impurity in the synthesis of Rivastigmine (R541000) a brain selective acetylcholinesterase inhibitor. Nootropic. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
| Company Name: |
BePharm Ltd
|
| Tel: |
400-685-9117 |
| Website: |
www.bepharm.com |
|