| Identification | Back Directory | [Name]
p-phenylenebis(trimellitate anhydride)) | [CAS]
2770-49-2 | [Synonyms]
TAHQ 1,4-Phenylene Bis(anhydrotrimellitate) p-phenylenebis(trimellitate anhydride)) p-Phenylene bis(trimellitate) dianhydride p-Phenylene bis(trimellitate) dianhydride,TAHQ P-PHENYLENEBIS (TRIMELLITATE ANHYDRIDE) (TAHQ) Bis(1,3-dioxo-1,3-dihydroisobenzofuran-5-carboxylate) Bis(1,3-dioxo-1,3-dihydroisobenzofuran-5-carboxylate) (TAHQ) 1,4-Phenylene Bis(1,3-dioxo-1,3-dihydroisobenzofuran-5-carboxylate) 1,4-Phenylene Bis(1,3-dioxo-1,3-dihydroisobenzof uran-5-carboxylate) (TAHQ) Bis(1,3-dioxo-1,3-dihydroisobenzofuran-5-carboxylic Acid) 1,4-Phenylene Ester 5-Isobenzofurancarboxylic acid, 1,3-dihydro-1,3-dioxo-, 5,5'-(1,4-phenylene) ester | [Molecular Formula]
C24H10O10 | [MDL Number]
MFCD00516832 | [MOL File]
2770-49-2.mol | [Molecular Weight]
458.33 |
| Chemical Properties | Back Directory | [Melting point ]
255 °C | [Boiling point ]
757.9±55.0 °C(Predicted) | [density ]
1.622±0.06 g/cm3(Predicted) | [form ]
powder to crystal | [color ]
White to Light yellow | [InChI]
InChI=1S/C24H10O10/c25-19(11-1-7-15-17(9-11)23(29)33-21(15)27)31-13-3-5-14(6-4-13)32-20(26)12-2-8-16-18(10-12)24(30)34-22(16)28/h1-10H | [InChIKey]
CXISKMDTEFIGTG-UHFFFAOYSA-N | [SMILES]
C1(OC(C2C=CC3C(=O)OC(=O)C=3C=2)=O)=CC=C(OC(C2C=CC3C(=O)OC(=O)C=3C=2)=O)C=C1 | [CAS DataBase Reference]
2770-49-2 |
|
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Telephone: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
| Company Name: |
TCI Chemicals
|
| Telephone: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
|