| Identification | Back Directory | [Name]
(10-Phenylanthracen-9-yl)boronic acid | [CAS]
334658-75-2 | [Synonyms]
(10-Phenylanthracen- 9-Borono-10-phenylanthracene 10-phenyl)anthracene -9-boronic (10-Phenylanthracen-9-yl)boronic (10-Phenyl-9-anthryl)boronic acid 10-Phenylanthracene-9-boronic acid 10-Phenyl-9-anthracene boronic acid (10-Phenylanthracen-9-yl)boronicaci 10-phenylantrhacen-9-yl boronic acid (10-Phenylanthracen-9-yl)boronic acid (9-Phenylanthracen-10-yl)boronic acid B-(10-Phenyl-9-anthracenyl)boronicacid (10-Phenyl-9-anthracenyl)-boronic acid 10-Phenylanthracene-9-boronic acid 97% 9-phenylanthracen-10-yl-10-boronic acid (10-phenylanthracene-9-based)boric acid Boronic acid, (10-phenyl-9-anthracenyl)- Boronic acid,B-(10-phenyl-9-anthracenyl)- (10-([1,1'-biphenyl]-3-yl)anthracen-9-yl)boronic acid (10-Phenylanthracen-9-yl)boronic acid ISO 9001:2015 REACH (10-PHENYL-9-ANTHRYL)BORONIC ACID;10-PHENYL-9-ANTHRACENE BORONIC ACID; 10-Phenyl-9-anthraceneboronic Acid (contains varying aMounts of Anhydride) | [Molecular Formula]
C20H15BO2 | [MDL Number]
MFCD11111989 | [MOL File]
334658-75-2.mol | [Molecular Weight]
298.14 |
| Chemical Properties | Back Directory | [Boiling point ]
521.3±53.0 °C(Predicted) | [density ]
1.27 | [storage temp. ]
Keep in dark place,Sealed in dry,Room Temperature | [solubility ]
Soluble in methanol. | [form ]
Solid | [pka]
8.59±0.30(Predicted) | [color ]
White to Almost white | [Sensitive ]
Light Sensitive | [InChI]
InChI=1S/C20H15BO2/c22-21(23)20-17-12-6-4-10-15(17)19(14-8-2-1-3-9-14)16-11-5-7-13-18(16)20/h1-13,22-23H | [InChIKey]
RVPCPPWNSMAZKR-UHFFFAOYSA-N | [SMILES]
B(C1C2=CC=CC=C2C(C2=CC=CC=C2)=C2C=1C=CC=C2)(O)O |
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Telephone: |
18210857532 18210857532 |
| Website: |
https://www.jkchemical.com |
| Company Name: |
Alfa Aesar
|
| Telephone: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Jia Xing Isenchem Co.,Ltd
|
| Telephone: |
0573-85285100 18627885956 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList14265/0_EN.htm |
| Company Name: |
China Langchem Inc.
|
| Telephone: |
0086-21-58956006 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList19141/0_EN.htm |
| Company Name: |
Spectrum Chemical Manufacturing Corp.
|
| Telephone: |
021-021-021-67601398-809-809-809 15221380277 |
| Website: |
www.spectrumchemical.com/oa_html/index.jsp?minisite=10020&respid=22372&language=us |
|