| Identification | Back Directory | [Name]
2,6-Ntp | [CAS]
50428-14-3 | [Synonyms]
2,6-Ntp Nifedipine-2 Nifidipine Impurity B Nifedipine Impurity II Nifedipine impurity B CRS Nifedipine impurity B (EP) Nifedipine dehydro nitroso-d6 Azilsartan medoxomil impurity307 Dimethyl 2,6-Dimethyl-4-(2-nitrosop Nifedipine Nitrosophenylpyridine Analog Nifedipine Impurity II:Dehydronitroso Nifedipine Nifedipine EP Impurity B (Dehydronitroso Nifedipine) 2,6-Dimethyl-4-(2-nitrosophenyl)-3,5-pyridinedicarboxylic Acid 4-(2-Nitrosophenyl)-2,6-diMethyl-3,5-diMethoxycarbonylpyridine Nifedipine EP Impurity B (Nifedipine nitrosophenylpyridine analog) Dimethyl 2,6-dimethyl-4-(2-nitrosophenyl)-3,5-pyridinedicarboxylate dimethyl 2,6-dimethyl-4-(2-nitrosophenyl)pyridine-3,5-dicarboxylate Dimethyl 4-(2-nitrosophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate 2,6-dimethyl-4-(2'-nitrosophenyl)-3,5-pyridinedicarboxylic acid dimethyl ester 3,5-Dimethyl Ester2,6-Dimethyl-3,5-dicarbomethoxy-4-(2-nitrosophenyl)pyridine 3,5-Pyridinedicarboxylic acid, 2,6-dimethyl-4-(2-nitrosophenyl)-, 3,5-dimethyl ester 2,6-DiMethyl-4-(2-nitrosophenyl)-3,5-pyridinedicarboxylic Acid 3,5-DiMethyl Ester
2,6-DiMethyl-3,5-dicarboMethoxy-4-(2-nitrosophenyl)pyridine | [Molecular Formula]
C17H16N2O5 | [MDL Number]
MFCD22572715 | [MOL File]
50428-14-3.mol | [Molecular Weight]
328.32 |
| Chemical Properties | Back Directory | [Melting point ]
93℃ | [Boiling point ]
449.0±45.0 °C(Predicted) | [density ]
1.26±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C | [solubility ]
Chloroform (Slightly), Methanol (Slightly) | [form ]
neat | [pka]
1.86±0.29(Predicted) | [Major Application]
pharmaceutical pharmaceutical small molecule | [InChI]
1S/C17H16N2O5/c1-9-13(16(20)23-3)15(11-7-5-6-8-12(11)19-22)14(10(2)18-9)17(21)24-4/h5-8H,1-4H3 | [InChIKey]
MUZLTKGYFZENFW-UHFFFAOYSA-N | [SMILES]
O=C(OC)C1=C(C2=C(N=O)C=CC=C2)C(C(OC)=O)=C(C)N=C1C |
| Hazard Information | Back Directory | [Uses]
A photodegradation product of Nifedipine (N457000). Shown to relax contractions of the rat aortic strip induced by norepinephrine and other agonists. |
|
| Company Name: |
SAG Chem
|
| Tel: |
+91-9819395336 |
| Website: |
www.sagchem.com |
|