| Identification | Back Directory | [Name]
(S)-(+)-4-PENTEN-2-OL | [CAS]
55563-79-6 | [Synonyms]
(S)-4-Pentene-2-ol (2S)-pent-4-en-2-ol (2S)-4-Pentene-2-ol 4-Penten-2-ol, (2S)- (S)-(+)-4-PENTEN-2-OL [S,(+)]-4-Pentene-2-ol (S)-(+)-4-Penten-2-ol 95% (S)-(+)-2-HYDROXYPENT-4-ENE (S)-(+)-4-PENTEN-2-OL, 95% (98% EE/GLC) | [Molecular Formula]
C5H10O | [MDL Number]
MFCD03427200 | [MOL File]
55563-79-6.mol | [Molecular Weight]
86.13 |
| Chemical Properties | Back Directory | [Boiling point ]
115-116 °C(lit.)
| [density ]
0.837 g/mL at 25 °C(lit.)
| [refractive index ]
n20/D 1.4240(lit.)
| [Fp ]
78 °F
| [storage temp. ]
2-8°C, stored under nitrogen | [pka]
15.10±0.20(Predicted) | [Appearance]
Colorless to light yellow Liquid | [Optical Rotation]
[α]20/D +5.0°, c = 1% in chloroform | [InChI]
InChI=1S/C5H10O/c1-3-4-5(2)6/h3,5-6H,1,4H2,2H3/t5-/m0/s1 | [InChIKey]
ZHZCYWWNFQUZOR-YFKPBYRVSA-N | [SMILES]
C[C@H](O)CC=C | [LogP]
1.033 (est) |
| Safety Data | Back Directory | [Hazard Codes ]
H226 | [Risk Statements ]
10 | [RIDADR ]
UN 1987 3/PG 3
| [WGK Germany ]
3
| [HazardClass ]
3 | [PackingGroup ]
III | [HS Code ]
2914290090 | [Storage Class]
3 - Flammable liquids | [Hazard Classifications]
Flam. Liq. 3 |
| Hazard Information | Back Directory | [Uses]
(S)-(+)-4-Penten-2-ol is involved in the synthesis of goniothalamin, hexadecanolide, massoia lactone, and parasorbic acid through sequential allylboration-esterification ring-closing metathesis reactions. It is also used to prepare 2-pentanone. |
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|