| Identification | Back Directory | [Name]
2,4-Diphenylimidazole | [CAS]
670-83-7 | [Synonyms]
2,4-DIPHENYLIMIDAZOLE
2,4-Diphenyl-1H-imidazole
2,5-Diphenyl-1H-imidazole
1H-Imidazole, 2,5-diphenyl-
2,4-Diphenyl-1H-imidazole 98% | [EINECS(EC#)]
1533716-785-6 | [Molecular Formula]
C15H12N2 | [MDL Number]
MFCD07772899 | [MOL File]
670-83-7.mol | [Molecular Weight]
220.27 |
| Chemical Properties | Back Directory | [Melting point ]
164-166 °C(Solv: ethanol (64-17-5)) | [Boiling point ]
461.2±14.0 °C(Predicted) | [density ]
1.149±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [form ]
solid | [pka]
12.39±0.10(Predicted) | [color ]
Off-white | [InChI]
InChI=1S/C15H12N2/c1-3-7-12(8-4-1)14-11-16-15(17-14)13-9-5-2-6-10-13/h1-11H,(H,16,17) | [InChIKey]
FHHCKYIBYRNHOZ-UHFFFAOYSA-N | [SMILES]
C1(C2=CC=CC=C2)NC(C2=CC=CC=C2)=CN=1 |
| Questions And Answer | Back Directory | [Uses]
2,4-Diphenylimidazole is an organic intermediate used in synthesis and pharmaceutical research. Furthermore, current research is exploring the applications of imidazole derivatives in the development of novel materials. For example, some studies have investigated the potential of imidazole derivatives as components of ionic liquids, which are salts with unique properties such as high thermal stability and electrical conductivity. |
|
|