| Identification | Back Directory | [Name]
(+)-8-PHENYLMENTHYL CHLOROACETATE | [CAS]
71804-27-8 | [Synonyms]
(+)-8-PHENYLMENTHYL CHLOROACETATE (1R,2S,5R)-(+)-5-methyl-2-(1-methyl-1-phenylethyl (1R,2S,5R)-(+)-5-METHYL-2-(1-METHYL-1-PHENYLETHYL)CYCLOHEXYL CHLOROACETATE (1R,2S,5R)-(+)-5-METHYL-2-(1-METHYL-1-PH ENYLETHYL)CYCLOHEXYL CL-ACETATE, 99% Acetic acid, chloro-, (1R,2S,5R)-5-methyl-2-(1-methyl-1-phenylethyl)cyclohexyl ester Acetic acid, 2-chloro-, (1R,2S,5R)-5-methyl-2-(1-methyl-1-phenylethyl)cyclohexyl ester | [Molecular Formula]
C18H25ClO2 | [MDL Number]
MFCD00040610 | [MOL File]
71804-27-8.mol | [Molecular Weight]
308.84 |
| Chemical Properties | Back Directory | [Melting point ]
82-84 °C (lit.) | [form ]
solid | [Optical Rotation]
[α]25/D +22°, c = 1.2 in carbon tetrachloride | [InChI]
1S/C18H25ClO2/c1-13-9-10-15(16(11-13)21-17(20)12-19)18(2,3)14-7-5-4-6-8-14/h4-8,13,15-16H,9-12H2,1-3H3/t13-,15-,16-/m1/s1 | [InChIKey]
GYWWQECFQIGECM-FVQBIDKESA-N | [SMILES]
C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)CCl)C(C)(C)c2ccccc2 |
| Hazard Information | Back Directory | [Uses]
(1R,2S,5R)-(+)-5-Methyl-2-(1-methyl-1-phenylethyl)cyclohexyl chloroacetate may be used in the synthesis of (-)-8-phenyl-menthol, (+)-8-phenylmenthyl isocyanoacetate and (+)-cularine. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|