| Identification | Back Directory | [Name]
BIS(PENTAMETHYLCYCLOPENTADIENYL)COBALT | [CAS]
74507-62-3 | [Synonyms]
CoCp*2 DECAMETHYLCOBALTOCENE Cobaltocene,decamethyl- BIS(PENTAMETHYLCYCLOPENTADIENYL)COBALT bis(pentamethylcyclopentadienyl)cobalt(ii) 1,1′,2,2′,3,3′,4,4′,5,5′-Decamethylcobaltocene Bis(pentamethylcyclopentadienyl)cobalt(II),CoCp*2, Decamethylcobaltocene | [Molecular Formula]
C20H30Co10* | [MDL Number]
MFCD02093610 | [MOL File]
74507-62-3.mol | [Molecular Weight]
329.39 |
| Chemical Properties | Back Directory | [Melting point ]
>210 °C(lit.) | [storage temp. ]
2-8°C | [form ]
solid | [InChI]
1S/2C10H15.Co/c2*1-6-7(2)9(4)10(5)8(6)3;/h2*1-5H3; | [InChIKey]
XDHJNPINFJSJJB-UHFFFAOYSA-N | [SMILES]
[Co].C[C]1[C](C)[C](C)[C](C)[C]1C.C[C]2[C](C)[C](C)[C](C)[C]2C |
| Hazard Information | Back Directory | [Uses]
Bis(pentamethylcyclopentadienyl)cobalt(II) can be used as:
- An n-type dopant to fabricate organic electronic materials such as copper phthalocyanine thin films.
- A reducing agent to synthesize high-quality reduced graphene oxide thin films at room temperature.
- A metal organic precursor for plasma-enhanced atomic layer deposition of cobalt.
| [General Description]
Atomic number of base material: 27 Cobalt | [reaction suitability]
core: cobalt |
|
| Company Name: |
INTATRADE GmbH
|
| Tel: |
+49 3493/605464 |
| Website: |
www.intatrade.de |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|