| Identification | Back Directory | [Name]
Bis[rhodium(a,a,a#,a#-tetramethyl-1,3-benzenedipropionic acid)], 96% | [CAS]
819050-89-0 | [Synonyms]
Rh2(esp)2 Bis[rhodium(&alpha Bis[rhodium(α,α,α',α'-tetramethyl-1,3-benzenedipropionic acid) bis[rhodium(α,α,α',α'-tetramethyl-1,3-benzenedipropionic acid)] Bis[rhodium(a,a,a#,a#-tetramethyl-1,3-benzenedipropionicacid)],96% Bis[rhodium(a,a,a#,a#-tetramethyl-1,3-benzenedipropionic acid)], 96% bis(lambda2-rhodium(2+)) bis(3-[3-(2-carboxylato-2,2-dimethylethyl)phenyl]-2,2-dimethylpropanoate) | [Molecular Formula]
2C16H22O4.Rh2 | [MDL Number]
MFCD08457636 | [MOL File]
819050-89-0.mol | [Molecular Weight]
762.512 |
| Chemical Properties | Back Directory | [Melting point ]
>300 °C | [storage temp. ]
Inert atmosphere,Room Temperature | [form ]
powder to crystal | [color ]
Yellow to Brown to Dark green | [InChI]
InChI=1S/2C16H22O4.2Rh/c2*1-15(2,13(17)18)9-11-6-5-7-12(8-11)10-16(3,4)14(19)20;;/h2*5-8H,9-10H2,1-4H3,(H,17,18)(H,19,20);; | [InChIKey]
OBMUTUNJWNQIAJ-UHFFFAOYSA-N | [SMILES]
[Rh][Rh].O=C(C(C)(CC1C=C(C=CC=1)CC(C)(C)C(O)=O)C)O.O=C(C(CC1=CC=CC(CC(C(O)=O)(C)C)=C1)(C)C)O |
|
| Company Name: |
Rhawn Reagent Gold
|
| Telephone: |
400-1332688 18019345275 |
| Website: |
https://www.rhawn.cn/ |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
LaaJoo
|
| Telephone: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
| Company Name: |
Henan Alpha Chemical Co., Ltd.
|
| Telephone: |
0371-55055611 18137792234 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList31206/0.htm |
|