| Identification | Back Directory | [Name]
(1R)-(-)-10-CAMPHORSULFONIC ACID, AMMONIUM SALT | [CAS]
82509-30-6 | [Synonyms]
Einecs 279-985-6 (1r)-(-)-10-camphorsulfonic (1R)-(-)-10-CAMPHORSULFONIC ACID, AMMONIUM SALT (1R)-(-)-10-Camphorsulfonic acid ammonium salt 98% (1R)-(-)-10-Camphorsulfonic acid ammonium salt >=97.0% (T) ammonium (1R)-[7,7-dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulphonate (1R,4S)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptane-1α-methanesulfonic acid ammonium salt | [EINECS(EC#)]
279-985-6 | [Molecular Formula]
C10H19NO4S | [MDL Number]
MFCD00012546 | [MOL File]
82509-30-6.mol | [Molecular Weight]
249.33 |
| Chemical Properties | Back Directory | [Appearance]
off-white powder | [Melting point ]
250 °C (dec.)(lit.)
| [form ]
solid | [Stability:]
Stable. Incompatible with strong oxidizing agents. | [Optical Rotation]
[α]22/D 18.4°, c = 5.3 in H2O | [InChI]
1S/C10H16O4S.H3N/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;/h7H,3-6H2,1-2H3,(H,12,13,14);1H3/t7-,10-;/m0./s1 | [InChIKey]
JTMZBRWRXFAITF-YUWZRIFDSA-N | [SMILES]
N.CC1(C)[C@H]2CC[C@]1(CS(O)(=O)=O)C(=O)C2 |
| Hazard Information | Back Directory | [Chemical Properties]
off-white powder | [Uses]
Reactant involved in the synthesis of chiral anionic liquids for use as solvents and chiral shift reagents | [General Description]
(1R)-(-)-10-Camphorsulfonic acid ammonium salt may be used as an ion-pair reagent to enhance the ability of supercritical carbon dioxide to extract polar compounds in supercritical fluid extraction (SFE) process. It can also be used in the synthesis of (-)-quadrone. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|