| Identification | More | [Name]
2-(4-Hydroxybenzoyl)benzoic acid | [CAS]
85-57-4 | [Synonyms]
2-(4-HYDROXYBENZOYL)BENZOIC ACID 2-(P-HYDROXYBENZOYL)BENZOIC AC ID AKOS B028764 2-(4-hydroxybenzoyl)-benzoicaci o-(p-hydroxybenzoyl)-benzoicaci o-(p-hydroxybenzoyl)benzoicacid phthaleinacid 2-(4-hydroxybenzoyI)benzoic acid Cyclopropanecarbonitrile, 1-(4-methoxyphenyl)- Hibenzate NSC-122980 NSC-57609 o-(4-Hydroxybenzoyl)benzoic acid | [EINECS(EC#)]
201-616-4 | [Molecular Formula]
C14H10O4 | [MDL Number]
MFCD00016507 | [Molecular Weight]
242.23 | [MOL File]
85-57-4.mol |
| Chemical Properties | Back Directory | [Melting point ]
213 °C | [Boiling point ]
512.6±35.0 °C(Predicted) | [density ]
1.356±0.06 g/cm3(Predicted) | [storage temp. ]
Inert atmosphere,Room Temperature | [form ]
Powder | [pka]
3.35±0.36(Predicted) | [InChI]
InChI=1S/C14H10O4/c15-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)14(17)18/h1-8,15H,(H,17,18) | [InChIKey]
YGTUPRIZNBMOFV-UHFFFAOYSA-N | [SMILES]
C(O)(=O)C1=CC=CC=C1C(=O)C1=CC=C(O)C=C1 | [CAS DataBase Reference]
85-57-4(CAS DataBase Reference) | [EPA Substance Registry System]
85-57-4(EPA Substance) |
| Hazard Information | Back Directory | [Description]
2-(4-Hydroxybenzoyl)benzoic acid is a white crystalline powder. It is sparingly soluble in water but soluble in organic solvents like ethanol and acetone. The compound has a melting point range of approximately 245-250 ℃. The synthesis of 2-(4-Hydroxybenzoyl)benzoic acid involves the reaction of 4-hydroxybenzoic acid (also known as p-hydroxybenzoic acid) with benzoyl chloride or benzoyl anhydride. The reaction occurs through an acylation process where the benzoyl group is added to the benzene ring of the 4-hydroxybenzoic acid. This compound has potential applications in various fields, including pharmaceuticals and materials science. It can serve as a building block for synthesising other organic compounds or as a starting material for preparing pharmaceutical intermediates. Additionally, it may exhibit certain properties that make it useful in developing materials or coatings. |
|
|