| Identification | Back Directory | [Name]
Ethanol, 2-[(2,6-dichlorophenyl)Methoxy]- | [CAS]
85309-91-7 | [Synonyms]
BNKY020-VT05 Vilanterol Impurity 52 Vilanterol Impurity 22 *Nifuratel Impurity 27 (Furan) (2, 6-Dichlorobenzyl) Oxy]Ethanol 2-[(2,6-Dichlorobenzyl)oxy]ethane 2-[(2,6-Dichlorobenzyl)oxy]ethanol 2-((2,6-dichlorobenzyl)oxy)ethan-1-ol 2-[(2,6-Dichlorophenyl)methoxy]-ethanol Ethanol, 2-[(2,6-dichlorophenyl)Methoxy]- 2-(2,6-Dichlorobenzyloxy)ethanolQ: What is
2-(2,6-Dichlorobenzyloxy)ethanol Q: What is the CAS Number of
2-(2,6-Dichlorobenzyloxy)ethanol | [EINECS(EC#)]
617-700-2 | [Molecular Formula]
C9H10Cl2O2 | [MDL Number]
MFCD21337361 | [MOL File]
85309-91-7.mol | [Molecular Weight]
221.08 |
| Chemical Properties | Back Directory | [Boiling point ]
318.8±32.0 °C(Predicted) | [density ]
1.327±0.06 g/cm3(Predicted) | [storage temp. ]
Store at room temperature | [pka]
14.30±0.10(Predicted) | [Appearance]
Colorless to light yellow Liquid | [InChI]
InChI=1S/C9H10Cl2O2/c10-8-2-1-3-9(11)7(8)6-13-5-4-12/h1-3,12H,4-6H2 | [InChIKey]
MCVIDUDFKDIJMZ-UHFFFAOYSA-N | [SMILES]
C(O)COCC1=C(Cl)C=CC=C1Cl |
|
|