| Company Name: |
Key Organics Ltd.
|
| Tel: |
+44 (0) 1840-212137 |
| Email: |
info@keyorganics.net |
| Products Intro: |
Cas:636-98-6
ProductName:4-Iodonitrobenzene
Brand:keyorganics | Product Number:STR06257-50G
|
| Company Name: |
Hubei zhonglong Kangsheng Fine Chemical Co., Ltd
|
| Tel: |
027-027-83850178 18162590268 |
| Email: |
1984393783@qq.com |
| Products Intro: |
Cas:636-98-6
ProductName:1-Iodo-4-nitrobenzene (p?Iodonitrobenzene)
Purity: 98% HPLC | Package: 1KG;5KG;25KG;100KG
|
| Company Name: |
Beijing Minruida Technology Co., Ltd.
|
| Tel: |
010-82387566 |
| Email: |
hr2@mreda.com.cn |
| Products Intro: |
Cas:636-98-6
ProductName:4-Iodonitrobenzene
Purity: >99% | Package: 10g;25g;100g
|
| Company Name: |
Apollo Scientific Ltd
|
| Tel: |
+44 (0)161 406 0505 |
| Email: |
sales@apolloscientific.co.uk |
| Products Intro: |
Cas:636-98-6
ProductName:4-Iodonitrobenzene
Brand:Apolloscientific | Product Number:OR4306 | Purity:98%
|
| Company Name: |
Guangdong Daxiao Chemical Co., Ltd
|
| Tel: |
171603 18666171603 |
| Email: |
3989665367@qq.com |
| Products Intro: |
Cas:636-98-6
ProductName:4-Iodonitrobenzene
Purity: 99.0% | Package: 500G;1KG;25KG;300KG
|
Iodonitrobenzene manufacturers
|
| | Iodonitrobenzene Basic information |
| | Iodonitrobenzene Chemical Properties |
| Melting point | 171-173 °C(lit.) | | Boiling point | 289 °C772 mm Hg(lit.) | | density | 1.8090 | | Fp | 100 °C | | storage temp. | Keep Cold | | form | Powder | | color | Brownish | | Water Solubility | insoluble | | Sensitive | Light Sensitive | | BRN | 1100378 | | Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. | | InChI | InChI=1S/C6H4INO2/c7-5-1-3-6(4-2-5)8(9)10/h1-4H | | InChIKey | SCCCFNJTCDSLCY-UHFFFAOYSA-N | | SMILES | C1(I)=CC=C([N+]([O-])=O)C=C1 | | CAS DataBase Reference | 636-98-6(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-iodo-4-nitro-(636-98-6) | | EPA Substance Registry System | Benzene, 1-iodo-4-nitro- (636-98-6) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38-36-33 | | Safety Statements | 26-37/39-36/37/39-36 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | IRRITANT, KEEP COLD, LIGHT SENSITIVE | | HS Code | 29049090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Iodonitrobenzene Usage And Synthesis |
| Chemical Properties | solid | | Uses | 1-Iodo-4-nitrobenzene is an important raw material and intermediate used in organic synthesis, pharmaceuticals agrochemicals and dyestuff fields. | | Purification Methods | Precipitate it from acetone by addition of water, followed by recrystallisation from EtOH. [Beilstein 8 H 523, 8 H 523, 8 II 191, 8 III 623, 8 IV 743.] |
| | Iodonitrobenzene Preparation Products And Raw materials |
|