| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (3-t-Butyl-5-methylphenyl)boronic acid Basic information |
| | (3-t-Butyl-5-methylphenyl)boronic acid Chemical Properties |
| Melting point | 158-160°C | | Boiling point | 322.6±52.0 °C(Predicted) | | density | 1.01±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 8.73±0.10(Predicted) | | form | solid | | color | White | | InChI | InChI=1S/C11H17BO2/c1-8-5-9(11(2,3)4)7-10(6-8)12(13)14/h5-7,13-14H,1-4H3 | | InChIKey | XWWPIVKWAIMBMU-UHFFFAOYSA-N | | SMILES | B(C1=CC(C)=CC(C(C)(C)C)=C1)(O)O | | CAS DataBase Reference | 193905-93-0 |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-41-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | Hazard Note | Harmful/Irritant/Keep Cold | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | (3-t-Butyl-5-methylphenyl)boronic acid Usage And Synthesis |
| Uses | 3-t-Butyl-5-methylphenylboronic acid |
| | (3-t-Butyl-5-methylphenyl)boronic acid Preparation Products And Raw materials |
|