(+/-)-2-(6-METHOXY-2-NAPHTHYL)PROPIONIC ACID manufacturers
|
| | (+/-)-2-(6-METHOXY-2-NAPHTHYL)PROPIONIC ACID Basic information |
| | (+/-)-2-(6-METHOXY-2-NAPHTHYL)PROPIONIC ACID Chemical Properties |
| Melting point | 157°C | | Boiling point | 403.9±20.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 4.84±0.30(Predicted) | | form | Solid | | color | White to Light red to Green | | Major Application | pharmaceutical small molecule | | InChI | 1S/C14H14O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3,(H,15,16) | | InChIKey | CMWTZPSULFXXJA-UHFFFAOYSA-N | | SMILES | O(C)c1cc2c(cc(cc2)C(C)C(=O)O)cc1 | | CAS DataBase Reference | 23981-80-8(CAS DataBase Reference) |
| Risk Statements | 36/37/38-36 | | Safety Statements | 26-36/37/39-36 | | RIDADR | 2811 | | WGK Germany | WGK 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29189900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | (+/-)-2-(6-METHOXY-2-NAPHTHYL)PROPIONIC ACID Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | An anti-inflammatory, analgesic, antipyretic. A non-steroidal anti-inflammatory. | | Definition | ChEBI: 2-(6-methoxy-2-naphthalenyl)propanoic acid is a member of naphthalenes. |
| | (+/-)-2-(6-METHOXY-2-NAPHTHYL)PROPIONIC ACID Preparation Products And Raw materials |
|