| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(N,N-Dimethylaminocarbonyl)phenylboronic acid Basic information |
| | 4-(N,N-Dimethylaminocarbonyl)phenylboronic acid Chemical Properties |
| Melting point | 141-145 °C | | Boiling point | 407.4±47.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder to crystal | | pka | 7.76±0.10(Predicted) | | color | White to Almost white | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C9H12BNO3/c1-11(2)9(12)7-3-5-8(6-4-7)10(13)14/h3-6,13-14H,1-2H3 | | InChIKey | QJYYVSIRDJVQJW-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(C(N(C)C)=O)C=C1)(O)O | | CAS DataBase Reference | 405520-68-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 1 | | Hazard Note | Irritant/Keep Cold | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-(N,N-Dimethylaminocarbonyl)phenylboronic acid Usage And Synthesis |
| Chemical Properties | White Crysstalline | | Uses | Reactant for preparation of:• ;Selective glucocorticoid receptor agonists1• ;(thienopyridine)carboxamides as checkpoint 1 kinase (CHK1) inhibitors2• ;[(pyrrolo[2,3-b]pyridinyl)methylene]hydroxybenzofuranones as ATP-competitive inhibitors of the mammalian target of rapamycin3• ;Pyrrolopyridines as inhibitors of insulin-like growth factor-1 receptor tyrosine kinase4Reactant for:• ;Copper-mediated N-arylation of quinazolinediones5 | | Uses | 4-(Dimethylcarbamoyl)benzeneboronic acid used in coupling reactions and as intermediates. | | General Description | May contain varying amounts of anhydride |
| | 4-(N,N-Dimethylaminocarbonyl)phenylboronic acid Preparation Products And Raw materials |
|