|
|
| | 6-Bromo-2-methylquinoline-3-carboxylic acid ethyl ester Basic information |
| Product Name: | 6-Bromo-2-methylquinoline-3-carboxylic acid ethyl ester | | Synonyms: | Ethyl 6-bromo-2-methylquinoline-3-carboxylate;6-bromo-2-methylquinoline-3-carboxylate ethyl ester;6-Bromo-2-methylquinoline-3-carboxylicacidethyleste;3-Quinolinecarboxylic acid, 6-bromo-2-methyl-, ethyl ester;6-Bromo-2-methylquinoline-3-carboxylic acid ethyl ester | | CAS: | 948289-14-3 | | MF: | C13H12BrNO2 | | MW: | 294.14 | | EINECS: | | | Product Categories: | | | Mol File: | 948289-14-3.mol |  |
| | 6-Bromo-2-methylquinoline-3-carboxylic acid ethyl ester Chemical Properties |
| Boiling point | 358.5±37.0 °C(Predicted) | | density | 1.444±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | solid | | pka | 3.21±0.50(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C13H12BrNO2/c1-3-17-13(16)11-7-9-6-10(14)4-5-12(9)15-8(11)2/h4-7H,3H2,1-2H3 | | InChIKey | WOWPFIGSWCNAHK-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1cc2cc(Br)ccc2nc1C |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | 6-Bromo-2-methylquinoline-3-carboxylic acid ethyl ester Usage And Synthesis |
| | 6-Bromo-2-methylquinoline-3-carboxylic acid ethyl ester Preparation Products And Raw materials |
|