| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
ChemShuttle, Inc. |
| Tel: |
0510-83588313-811 18800520310 |
| Email: |
sales@chemshuttle.com |
|
| | Methyl 3,5-dichloropyrazine-2-carboxylate Basic information |
| Product Name: | Methyl 3,5-dichloropyrazine-2-carboxylate | | Synonyms: | Pyrazinecarboxylic acid, 3,5-dichloro-, Methyl ester;3,5-Dichloro-pyrazine-2-carboxylic acid Methyl ester;2-Methoxycarbonyl-3,5-dichloropyrazine;2-Pyrazinecarboxylic acid, 3,5-dichloro-, methyl ester;Methyl 3,5-dichloro-2-pyrazinecarboxylate;METHYL 3,5-DICHLOROPYRAZINE-2-CARBOXYLATE 98%;Methyl 3,5-dichloropyrazine-2-carboxylate | | CAS: | 330786-09-9 | | MF: | C6H4Cl2N2O2 | | MW: | 207.01 | | EINECS: | | | Product Categories: | | | Mol File: | 330786-09-9.mol |  |
| | Methyl 3,5-dichloropyrazine-2-carboxylate Chemical Properties |
| Boiling point | 269.5±35.0 °C(Predicted) | | density | 1.503±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -5.96±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H4Cl2N2O2/c1-12-6(11)4-5(8)10-3(7)2-9-4/h2H,1H3 | | InChIKey | VEDWLDKMRDJFNF-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=NC=C(Cl)N=C1Cl |
| | Methyl 3,5-dichloropyrazine-2-carboxylate Usage And Synthesis |
| Synthesis | At 23 °C, 3,5-dichloropyrazine-2-carboxylic acid (2.68 g, 13.9 mmol) and sodium bicarbonate (1.4 g, 16.6 mmol) were dissolved in DMF (20 mL), followed by addition of iodomethane (5.21 mL, 83 mmol). After completion of the reaction, the reaction mixture was diluted with 10% aqueous citric acid and extracted with EtOAc. The organic layers were combined, washed sequentially with water and brine, dried over anhydrous MgSO4 and concentrated under reduced pressure to afford the brown solid product methyl 3,5-dichloropyrazine-2-carboxylate (2.83 g, 13.6 mmol, 98% yield). The structure of the product was confirmed by 1H NMR (400 MHz, DMSO-d6): δ 3.95 (s, 3H), 8.94 (s, 1H). | | References | [1] Patent: WO2009/89042, 2009, A1. Location in patent: Page/Page column 113
[2] Patent: WO2018/81091, 2018, A1. Location in patent: Paragraph 0127; 0128; 0129
[3] Patent: US2014/148454, 2014, A1. Location in patent: Paragraph 0700
[4] Patent: WO2014/82739, 2014, A1. Location in patent: Page/Page column 64
[5] Patent: US2004/142930, 2004, A1 |
| | Methyl 3,5-dichloropyrazine-2-carboxylate Preparation Products And Raw materials |
|