|
|
| | 3-Chloro-2-pyrazine-carboxylic acid Basic information |
| | 3-Chloro-2-pyrazine-carboxylic acid Chemical Properties |
| Melting point | 116-117 °C (decomp) | | Boiling point | 317.0±37.0 °C(Predicted) | | density | 1.579±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 1.51±0.25(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C5H3ClN2O2/c6-4-3(5(9)10)7-1-2-8-4/h1-2H,(H,9,10) | | InChIKey | PMRPVXLESNMKLG-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=NC=CN=C1Cl | | CAS DataBase Reference | 27398-39-6(CAS DataBase Reference) |
| | 3-Chloro-2-pyrazine-carboxylic acid Usage And Synthesis |
| Uses | 3-Chloro-2-pyrazinecarboxylic Acid is used in the synthesis of a novel inhibitor (CX-4945) of protein kinase CK2 in the treatment of cancer. Also used in the synthesis of annulated pyrazoles as inhibitors of HIV-1 reverse transcriptase. |
| | 3-Chloro-2-pyrazine-carboxylic acid Preparation Products And Raw materials |
|