- 2-(3-bromophenyl)Naphthalene
-
- $101.00 / 1KG
-
2023-12-29
- CAS:667940-23-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-(3-bromophenyl)Naphthalene Basic information |
| Product Name: | 2-(3-bromophenyl)Naphthalene | | Synonyms: | 2-(3-bromophenyl)Naphthalene;2-(3-bromophenyl)phthalene;2-(3-broMophenyl)naphthale;2-(3-Bromophenyl)naphthalene,98%;Naphthalene, 2-(3-bromophenyl)-;2-(3-Bromophenyl)naphthalene > | | CAS: | 667940-23-0 | | MF: | C16H11Br | | MW: | 283.16 | | EINECS: | 1592732-453-0 | | Product Categories: | | | Mol File: | 667940-23-0.mol |  |
| | 2-(3-bromophenyl)Naphthalene Chemical Properties |
| Melting point | 97.0 to 101.0 °C | | Boiling point | 385.2±11.0 °C(Predicted) | | density | 1.381±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Sealed in dry,Room Temperature | | form | Solid | | color | White to Yellow to Orange | | InChI | InChI=1S/C16H11Br/c17-16-7-3-6-14(11-16)15-9-8-12-4-1-2-5-13(12)10-15/h1-11H | | InChIKey | FWPXWVYUNHYGPE-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2)=CC=C1C1=CC=CC(Br)=C1 | | CAS DataBase Reference | 667940-23-0 |
| | 2-(3-bromophenyl)Naphthalene Usage And Synthesis |
| Chemical Properties | Type of white solid |
| | 2-(3-bromophenyl)Naphthalene Preparation Products And Raw materials |
|