|
|
| | gamma-Glu-Cys trifluoroacetate salt Basic information | | Description |
| Product Name: | gamma-Glu-Cys trifluoroacetate salt | | Synonyms: | H-GLU(CYS-OH)-OH TFA;(DES-GLY)-GLUTATHIONE TFA (REDUCED);G-glu-cys trifluoroacetate;des-gly-glutathione reduced form;2-amino-5-(1-carboxy-2-sulfanyl-ethyl)amino-5-oxo-pentanoic acid;γ-L-Glutamyl-L-cysteine, des-Gly-glutathione reduced form;(2S)-2-amino-5-[[(1R)-2-hydroxy-2-keto-1-(mercaptomethyl)ethyl]amino]-5-keto-valeric acid;(2S)-2-amino-5-[[(2R)-1-hydroxy-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid | | CAS: | 636-58-8 | | MF: | C8H14N2O5S | | MW: | 250.27 | | EINECS: | | | Product Categories: | | | Mol File: | 636-58-8.mol |  |
| | gamma-Glu-Cys trifluoroacetate salt Chemical Properties |
| Melting point | 167℃ | | Boiling point | 592.4±50.0 °C(Predicted) | | density | 1.436±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | ≥ 25mg/mL in Water, ≥ 52 mg/mL in DMSO, ≥ 54.8 mg/mL in EtOH | | form | Solid | | pka | 2.21±0.10(Predicted) | | color | White to off-white | | InChI | InChI=1S/C8H14N2O5S/c9-4(7(12)13)1-2-6(11)10-5(3-16)8(14)15/h4-5,16H,1-3,9H2,(H,10,11)(H,12,13)(H,14,15)/t4-,5-/m0/s1 | | InChIKey | RITKHVBHSGLULN-WHFBIAKZSA-N | | SMILES | C(O)(=O)[C@@H](N)CCC(N[C@H](C(O)=O)CS)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | gamma-Glu-Cys trifluoroacetate salt Usage And Synthesis |
| Description | Gamma-glutamylcysteine (γ-Glutamylcysteine) is a cysteine and glutamic acid-containing dipeptide that is a precursor to glutathione (GSH). Gamma-glutamylcysteine is a cofactor for glutathione peroxidase (GPx) to increase GSH levels. | | Uses | γ-Glu-Cys is used to study the active sites and kinetics of glutathione synthetase(s). It has also been used for the extraction and quantification of low molecular weight thiols from Arabidopsis tissues. | | Definition | ChEBI: A molecular entity formed when L-cysteine amino group binds to the gamma-carbonyl of L-glutamic acid. | | Biochem/physiol Actions | γ-L-Glutamyl-L-cysteine (γ-Glu-Cys) is a substrate used for the biosynthesis of L-glutathione by glutathione synthetase(s). γ-Glu-Cys is generated by the cleavage of the Cys-Gly peptide bond of glutathione. It is also essential for the formation of phytochelatins, which are cysteine-rich thiol-reactive peptides. | | IC 50 | Human Endogenous Metabolite |
| | gamma-Glu-Cys trifluoroacetate salt Preparation Products And Raw materials |
|