| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
2-Chloro-5-nitrocinnamic acid manufacturers
|
| | 2-Chloro-5-nitrocinnamic acid Basic information |
| Product Name: | 2-Chloro-5-nitrocinnamic acid | | Synonyms: | 3-(2-CHLORO-5-NITROPHENYL)ACRYLIC ACID;2-Chloro-5-nitrocinnamic acid, predominantly trans, 98%;2-CHLORO-5-NITROCINNAMIC ACID, 98%, PREDOMINANTLY TRANS, PURE;2-Chloro-5-nitrocinnamic acid, predominantly trans, pure;3-(2-Chloro-5-nitrophenyl)propenoic acid;5-Nitro-2-chlorocinnamic acid;2-Chloro-5-nitrocinnamic acid,98%,pure,predominantly trans;trans-2-Chloro-5-nitrocinnamic acid | | CAS: | 36015-19-7 | | MF: | C9H6ClNO4 | | MW: | 227.6 | | EINECS: | | | Product Categories: | Aromatic Cinnamic Acids, Esters and Derivatives | | Mol File: | 36015-19-7.mol |  |
| | 2-Chloro-5-nitrocinnamic acid Chemical Properties |
| Melting point | 218-222 °C | | Boiling point | 401.7±35.0 °C(Predicted) | | density | 1.529±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.6000 (estimate) | | storage temp. | Storage temp. 2-8°C | | form | powder to crystal | | pka | 3.97±0.10(Predicted) | | color | White to Yellow to Green | | BRN | 1972431 | | InChI | InChI=1S/C9H6ClNO4/c10-8-3-2-7(11(14)15)5-6(8)1-4-9(12)13/h1-5H,(H,12,13) | | InChIKey | IHTLKLSRRSWIGD-UHFFFAOYSA-N | | SMILES | C(O)(=O)C=CC1=CC([N+]([O-])=O)=CC=C1Cl | | CAS DataBase Reference | 36015-19-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | HazardClass | IRRITANT | | HS Code | 2921490090 |
| | 2-Chloro-5-nitrocinnamic acid Usage And Synthesis |
| Chemical Properties | light beige crystalline powder |
| | 2-Chloro-5-nitrocinnamic acid Preparation Products And Raw materials |
|