| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N,N-Diethyl-o-toluidine Basic information |
| Product Name: | N,N-Diethyl-o-toluidine | | Synonyms: | n,n-diethyl-2-methyl-benzenamine;N,N-Diethyl-ortho-toluidine;N,N-Diethyl-2-methylbenzenaminium;diethyl-(2-methylphenyl)amine;2-Diethylaminotoluene
N,N-Diethyl-2-methylaniline;diethyl-o-toluidine;n,n-diethyl-2-methyl-benzenamin;N,N-Diethyl-o-toluidinium ion | | CAS: | 606-46-2 | | MF: | C11H17N | | MW: | 163.26 | | EINECS: | 210-119-1 | | Product Categories: | | | Mol File: | 606-46-2.mol |  |
| | N,N-Diethyl-o-toluidine Chemical Properties |
| Melting point | -60°C | | Boiling point | 210°C | | density | 0,92 g/cm3 | | refractive index | 1.5040-1.5070 | | Water Solubility | Soluble in water | | form | clear liquid | | pka | 7.24(at 25℃) | | Specific Gravity | 0.905 (20/4℃) | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C11H17N/c1-4-12(5-2)11-9-7-6-8-10(11)3/h6-9H,4-5H2,1-3H3 | | InChIKey | YQYUUNRAPYPAPC-UHFFFAOYSA-N | | SMILES | C1(N(CC)CC)=CC=CC=C1C | | CAS DataBase Reference | 606-46-2(CAS DataBase Reference) | | EPA Substance Registry System | Benzenamine, N,N-diethyl-2-methyl- (606-46-2) |
| | N,N-Diethyl-o-toluidine Usage And Synthesis |
| Chemical Properties | Colorless or light yellow oily liquid. Boiling point 208-209 ℃ (100.7kPa). Soluble in ethanol and ether, insoluble in water. | | Uses | N,n-diethyl-o-toluidine is used in organic synthesis. | | Synthesis | N,n-diethyl-o-toluidine is obtained by the reaction of o-toluidine and ethyl bromide. | | Toxics Screening Level | The initial threshold screening level (ITSL) for N,N-diethyl-o-toludine is 0.1 μg/m3 based
on an annual averaging time. |
| | N,N-Diethyl-o-toluidine Preparation Products And Raw materials |
|