N3-PEG7-OH manufacturers
- azido-PEG7-OH
-
-
2025-06-07
- CAS:1274892-60-2
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | N3-PEG7-OH Basic information |
| Product Name: | N3-PEG7-OH | | Synonyms: | N3-PEG7-OH;Azido-PEG7-OH;20-azido-3,6,9,12,15,18-hexaoxaicosan-1-ol;N3-PEG7-OH/3,6,9,12,15,18-Hexaoxaeicosan-1-ol, 20-azido-;N?-PEG7-OH;Azido-PEG7-ol | | CAS: | 1274892-60-2 | | MF: | C14H29N3O7 | | MW: | 351.4 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1274892-60-2.mol |  |
| | N3-PEG7-OH Chemical Properties |
| storage temp. | Store at Room Tem. | | solubility | Soluble in Water, DMSO, DCM, DMF | | InChI | InChI=1S/C14H29N3O7/c15-17-16-1-3-19-5-7-21-9-11-23-13-14-24-12-10-22-8-6-20-4-2-18/h18H,1-14H2 | | InChIKey | IKLKCSJOBKMTTI-UHFFFAOYSA-N | | SMILES | C(COCCOCCOCCO)OCCOCCOCCN=[N+]=[N-] |
| | N3-PEG7-OH Usage And Synthesis |
| Description | Azido-PEG7-alcohol is a aqueous soluble PEGylation reagent The azide group can react with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage. Hydroxy group further increase the reagnt's water solubility. | | Uses | Azido-PEG7-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG7-alcohol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | N3-PEG7-OH Preparation Products And Raw materials |
|