| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2-Ethoxy-4-nitrobenzoic acid manufacturers
|
| | 2-Ethoxy-4-nitrobenzoic acid Basic information |
| | 2-Ethoxy-4-nitrobenzoic acid Chemical Properties |
| Melting point | 148-151 °C(lit.) | | Boiling point | 395.9±27.0 °C(Predicted) | | density | 1.368±0.06 g/cm3(Predicted) | | pka | 3.24±0.13(Predicted) | | form | crystalline solid | | color | Light yellow | | InChI | 1S/C9H9NO5/c1-2-15-8-5-6(10(13)14)3-4-7(8)9(11)12/h3-5H,2H2,1H3,(H,11,12) | | InChIKey | BSIOETYGDXDWBR-UHFFFAOYSA-N | | SMILES | CCOc1cc(ccc1C(O)=O)[N+]([O-])=O | | CAS DataBase Reference | 2486-66-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids |
| | 2-Ethoxy-4-nitrobenzoic acid Usage And Synthesis |
| Chemical Properties | White powder |
| | 2-Ethoxy-4-nitrobenzoic acid Preparation Products And Raw materials |
|