|
|
| | 2-Chloro-5-chloromethylthiazole Basic information | | Description |
| | 2-Chloro-5-chloromethylthiazole Chemical Properties |
| Melting point | 31 | | Boiling point | 268.6±32.0 °C(Predicted) | | density | 1.503±0.06 g/cm3(Predicted) | | refractive index | n20/D1.571 | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | soluble in Methanol | | pka | 0.19±0.10(Predicted) | | color | White to Light yellow | | BRN | 5861439 | | InChI | InChI=1S/C4H3Cl2NS/c5-1-3-2-7-4(6)8-3/h2H,1H2 | | InChIKey | VRMUIVKEHJSADG-UHFFFAOYSA-N | | SMILES | S1C(CCl)=CN=C1Cl | | CAS DataBase Reference | 105827-91-6(CAS DataBase Reference) |
| | 2-Chloro-5-chloromethylthiazole Usage And Synthesis |
| Description | 2-Chloro-5-chloromethylthiazole is used as pharmaceutical and agrochemical intermediate. It is also used as intermediate of insecticides Thiamethoxam and Clothianidin. It is also useful in in the synthesis of Ritonavir (R535000); a second-generation anti-AIDS drug and a selective HIV protease inhibitor.
| | Chemical Properties | White crystal or powder | | Uses | 2-Chloro-5-(chloromethyl)thiazole is a useful synthetic intermediate used in the synthesis of Ritonavir (R535000) |
| | 2-Chloro-5-chloromethylthiazole Preparation Products And Raw materials |
|