|
|
| | 2-Chloroadenosine hemidydrate Basic information | | Uses |
| | 2-Chloroadenosine hemidydrate Chemical Properties |
| Melting point | 160 °C (dec.)(lit.) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | form | powder | | InChI | 1S/2C10H12ClN5O4.H2O/c2*11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(19)5(18)3(1-17)20-9;/h2*2-3,5-6,9,17-19H,1H2,(H2,12,14,15);1H2/t2*3-,5-,6-,9-;/m11./s1 | | InChIKey | WRURCFOLSGPTMO-IZGCVNAISA-N | | SMILES | O[C@H]1[C@@H](O)[C@H](N(C=N2)C3=C2C(N)=NC(Cl)=N3)O[C@@H]1CO.O[C@H]4[C@@H](O)[C@H](N(C=N5)C6=C5C(N)=NC(Cl)=N6)O[C@@H]4CO.O | | CAS DataBase Reference | 81012-94-4 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | Hazard Note | Harmful | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Chloroadenosine hemidydrate Usage And Synthesis |
| Uses | 2-Chloroadenosine can effectively inhibit the expression of tumor metastasis-related genes mtal and mRNA, and has inhibitory effects on various cancer cells. For example, it inhibits the in vitro invasion of highly metastatic human ovarian cancer cells HO-8910PM and the growth of human prostate cancer cells. 2-Chloroadenosine can also significantly increase spinal cord blood flow after injury, thereby improving post-injury neurological function. Furthermore, it is an important pharmaceutical intermediate; it can be used as a raw material to synthesize the anti-leukemia drug cladribine (2-chlorodeoxyadenosine). | | Chemical Properties | white crystalline powder |
| | 2-Chloroadenosine hemidydrate Preparation Products And Raw materials |
|