| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (3aR)-3A 5A 6A 6b-tetrahydro-2 2-di- Basic information |
| Product Name: | (3aR)-3A 5A 6A 6b-tetrahydro-2 2-di- | | Synonyms: | [3aR-(3aα,5aβ,6aβ,6bα)]-3a,5a,6a,6b-Tetrahydro-2,2-diMethyl oxireno[e]-1,3-benzodioxole,96%;(3ar)-3A,5A,6A,6B-tetrahydro-2,2-di-methyloxireno;(3AR)-3A,5A,6A,6B-TETRAHYDRO-2,2-DI-METH;[3ar-(3aα,5aβ,6aβ,6bα)]-3a,5a,6a,6b-tetrahydro-2,2-dimethyloxireno[e]-1,3-benzodioxole;Oxireno[e]-1,3-benzodioxole,3a,5a,6a,6b-tetrahydro-2,2-dimethyl-,(3aR,5aR,6aR,6bR)-(9CI);(3aR,5aR,6aR,6bR)-2,2-dimethyl-3a,5a,6a,6b-tetrahydrooxireno[2,3-g][1,3]benzodioxole;[3aR-(3aα,5aβ,6aβ,6bα)]-3a,5a,6a,6b-Tetrahydro-2,2-dimethyloxireno[e]-1,3-benzodioxole;[3aR-(3aα,5aβ,6aβ,6bα)]-3a,5a,6a,6b-Tetrahydro-2,2-dimethyloxireno[e]-1,3-benzodioxole, CAS 145107-27-3 | | CAS: | 145107-27-3 | | MF: | C9H12O3 | | MW: | 168.19 | | EINECS: | | | Product Categories: | EPOXYDE;Chiral Building Blocks;Epoxides;Organic Building Blocks | | Mol File: | 145107-27-3.mol |  |
| | (3aR)-3A 5A 6A 6b-tetrahydro-2 2-di- Chemical Properties |
| Boiling point | 79 °C1.5 mm Hg(lit.) | | density | 1.101 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.476(lit.) | | Fp | 198 °F | | storage temp. | -20°C | | Optical Rotation | [α]18/D 56°, c = 1.3 in chloroform | | InChI | 1S/C9H12O3/c1-9(2)11-6-4-3-5-7(10-5)8(6)12-9/h3-8H,1-2H3/t5-,6-,7-,8-/m1/s1 | | InChIKey | GAUDXMCZQNKKEF-WCTZXXKLSA-N | | SMILES | [H][C@]12O[C@@]1([H])[C@]3([H])OC(C)(C)O[C@]3([H])C=C2 |
| RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids not in Storage Class 3 |
| | (3aR)-3A 5A 6A 6b-tetrahydro-2 2-di- Usage And Synthesis |
| | (3aR)-3A 5A 6A 6b-tetrahydro-2 2-di- Preparation Products And Raw materials |
|