|
|
| | Estrone 3-sulfate sodium salt Basic information |
| Product Name: | Estrone 3-sulfate sodium salt | | Synonyms: | ESTRONE SULFATE SODIUM;ESTRONE 3-SULFATE SODIUM SALT;3-HYDROXY-1,3,5[10]-ESTRATRIEN-17-ONE 3-SULFATE SODIUM SALT;3-HYDROXY-1,3,5(10)-ESTRATRIEN-17-ONE 3-SULPHATE;1,3,5(10)-ESTRATRIEN-3-OL-17-ONE 3-SULFATE SODIUM;1,3,5[10]-ESTRATRIEN-3-OL-17-ONE SULFATE SODIUM SALT;1,3,5(10)-ESTRATRIEN-3-OL-17-ONE SULPHATE, SODIUM SALT;1,3,5(10)-ESTRATRIEN-17-ONE 3-SULFATE SODIUM SALT | | CAS: | 438-67-5 | | MF: | C18H21NaO5S | | MW: | 372.41 | | EINECS: | 207-120-4 | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;Steroids | | Mol File: | 438-67-5.mol |  |
| | Estrone 3-sulfate sodium salt Chemical Properties |
| Melting point | 258-260°C | | storage temp. | -20°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | biological source | synthetic (organic) | | Stability: | Hygroscopic | | InChIKey | GQZNDBBLTDOIBE-DLEHHZMWSA-N | | SMILES | [Na].[H][C@]12CC[C@]3(C)C(=O)CC[C@@]3([H])[C@]1([H])CCc4cc(OS(O)(=O)=O)ccc24 | | CAS DataBase Reference | 438-67-5 |
| Hazard Codes | T | | Risk Statements | 45-36/37/38 | | Safety Statements | 53-45-26 | | WGK Germany | 3 | | RTECS | KG8775000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Carc. 2
Lact.
Repr. 1A | | Hazardous Substances Data | 438-67-5(Hazardous Substances Data) |
| | Estrone 3-sulfate sodium salt Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Estrogen used in hormone replacement therapy. | | Uses | Estrone 3-Sulfate SodiuM Salt is used in hormone replacement therapy. | | Definition | ChEBI: Estrone sodium sulfate is a steroid sulfate and an organic sodium salt. It is functionally related to an estrone. | | Safety Profile | Confirmed carcinogen.
Experimental reproductive effects. When
heated to decomposition it emits toxic
fumes of SOx. | | IC 50 | Human Endogenous Metabolite |
| | Estrone 3-sulfate sodium salt Preparation Products And Raw materials |
|