DICAPTHON manufacturers
- DICAPTHON
-
- $15.00
-
2021-08-12
- CAS:2463-84-5
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| | DICAPTHON Basic information |
| Product Name: | DICAPTHON | | Synonyms: | dicapthon (ansi,esa);phosphorothioicacid,o-(2-chloro-4-nitrophenyl)o,o-dimethylester;phosphorothioicacido-(2-chloro-4-nitrophenyl)o,o-dimethylester;p-Nitro-o-chlorophenyl dimethyl thionophosphate;p-nitro-o-chlorophenyldimethylthionophosphate;Thiophosphate de O,O-dimethyle et de O-4-chloro-3-nitrophenyle;thiophosphatedeo,o-dimethyleetdeo-4-chloro-3-nitrophenyle;thiophosphatedeo,o-dimethyleetdeo-4-chloro-3-nitrophenyle(french) | | CAS: | 2463-84-5 | | MF: | C8H9ClNO5PS | | MW: | 297.65 | | EINECS: | | | Product Categories: | Alpha sort;D;DAlphabetic;DIA - DICPesticides;Insecticides;Organophorous;Pesticides&Metabolites | | Mol File: | 2463-84-5.mol |  |
| | DICAPTHON Chemical Properties |
| Melting point | 53℃ | | Boiling point | 355.8±52.0 °C(Predicted) | | density | 1.499±0.06 g/cm3(Predicted) | | form | Solid | | Water Solubility | 7.8mg/L(room temperature) | | Henry's Law Constant | 1.0×102 mol/(m3Pa) at 25℃, HSDB (2015) | | CAS DataBase Reference | 2463-84-5 | | EPA Substance Registry System | Dicapthon (2463-84-5) |
| Hazard Codes | Xn | | Risk Statements | 21/22 | | Safety Statements | 36 | | RIDADR | 2783 | | RTECS | TE7875000 | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29201900 | | Hazardous Substances Data | 2463-84-5(Hazardous Substances Data) | | Toxicity | LD50 in male, female rats (mg/kg): 400, 330 orally; 790, 1250 dermally (Gaines) |
| | DICAPTHON Usage And Synthesis |
| Chemical Properties | White crystalline powder. Melting point 53°C. Soluble in most organic solvents, insoluble in water. | | Uses | Insecticide. | | Uses | Dicapthon is an organophosphorus pesticide. | | Production Methods | Dicapthon is commercially produced by esterification of O,O-dimethyl phosphorothioic acid with 2-chloro-4-nitrophenol. The process begins with the preparation of the phosphorothioic acid derivative, typically from phosphorus oxychloride or phosphorus pentasulfide, followed by controlled reaction with the chloronitrophenol in an organic solvent. Catalysts and temperature regulation are used to ensure selective formation of the thiono ester. After synthesis, the crude product undergoes purification steps such as vacuum distillation or recrystallisation to yield technical-grade dicapthon. | | Mechanism of action | Contact and stomach insecticide. Acetylcholinesterase (AchE) inhibitor. | | Pesticide Type | Insecticide; Acaricide |
| | DICAPTHON Preparation Products And Raw materials |
|