|
|
| | 4-Chloro-6,7-bis(2-methoxyethoxy)quinazoline Basic information |
| | 4-Chloro-6,7-bis(2-methoxyethoxy)quinazoline Chemical Properties |
| Melting point | 105-107 °C | | Boiling point | 446.7±45.0 °C(Predicted) | | density | 1.257 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO: ≥20mg/mL | | form | powder | | pka | 0.54±0.30(Predicted) | | color | white to off-white | | InChI | InChI=1S/C14H17ClN2O4/c1-18-3-5-20-12-7-10-11(16-9-17-14(10)15)8-13(12)21-6-4-19-2/h7-9H,3-6H2,1-2H3 | | InChIKey | ZPJLDMNVDPGZIU-UHFFFAOYSA-N | | SMILES | N1=C2C(C=C(OCCOC)C(OCCOC)=C2)=C(Cl)N=C1 | | CAS DataBase Reference | 183322-18-1(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 4-Chloro-6,7-bis(2-methoxyethoxy)quinazoline Usage And Synthesis |
| Uses | 4-Chloro-6,7-bis(2-methoxyethoxy)quinazoline is an aurora 2 kinase inhibitor, PDGF inhibitor, useful in the treatment of cancer. | | Biological Activity | CP-335963 is an aurora 2 kinase inhibitor, PDGF inhibitor, and anti-proliferative. |
| | 4-Chloro-6,7-bis(2-methoxyethoxy)quinazoline Preparation Products And Raw materials |
|