|
|
| | 9-Fluorenone-4-carboxylic acid Basic information |
| | 9-Fluorenone-4-carboxylic acid Chemical Properties |
| Melting point | 225-227 °C(lit.) | | Boiling point | 476.5±24.0 °C(Predicted) | | density | 1.424±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.46±0.20(Predicted) | | form | powder to crystal | | color | Light orange to Yellow to Green | | BRN | 2694801 | | InChI | InChI=1S/C14H8O3/c15-13-9-5-2-1-4-8(9)12-10(13)6-3-7-11(12)14(16)17/h1-7H,(H,16,17) | | InChIKey | AFQYQSWTVCNJQT-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C2=C1C=CC=C2C(O)=O | | CAS DataBase Reference | 6223-83-2(CAS DataBase Reference) | | NIST Chemistry Reference | 9-Fluorenone-4-carboxylic acid(6223-83-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2918.30.3000 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 9-Fluorenone-4-carboxylic acid Usage And Synthesis |
| Uses | 4-Carboxy-9-fluorenone can be used for electrophotographic photosensitive member. |
| | 9-Fluorenone-4-carboxylic acid Preparation Products And Raw materials |
|